C40H60N3O9P — CID 59801731
[17-[3-[3-[(3-amino-2-hydroxy-6-methoxybenzoyl)amino]propylamino]-3-oxopropoxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] dibutyl phosphate (PubChem CID 59801731) has the molecular formula C40H60N3O9P and a molecular weight of 757.91 g/mol. Its IUPAC name is [17-[3-[3-[(3-amino-2-hydroxy-6-methoxybenzoyl)amino]propylamino]-3-oxopropoxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] dibutyl phosphate.
| Compound Name | [17-[3-[3-[(3-amino-2-hydroxy-6-methoxybenzoyl)amino]propylamino]-3-oxopropoxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] dibutyl phosphate |
|---|---|
| PubChem CID | 59801731 |
| Molecular Formula | C40H60N3O9P |
| Molecular Weight | 757.91 g/mol |
| Exact Mass | 757.41 |
| IUPAC Name | [17-[3-[3-[(3-amino-2-hydroxy-6-methoxybenzoyl)amino]propylamino]-3-oxopropoxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] dibutyl phosphate |
| SMILES | CCCCOP(=O)(OCCCC)Oc1ccc2c(c1)CCC1C2CCC2(C)C(OCCC(=O)NCCCNC(=O)c3c(OC)ccc(N)c3O)CCC12 |
| InChI | InChI=1S/C40H60N3O9P/c1-5-7-23-50-53(47,51-24-8-6-2)52-28-11-13-29-27(26-28)10-12-31-30(29)18-20-40(3)32(31)14-17-35(40)49-25-19-36(44)42-21-9-22-43-39(46)37-34(48-4)16-15-33(41)38(37)45/h11,13,15-16,26,30-32,35,45H,5-10,12,14,17-25,41H2,1-4H3,(H,42,44)(H,43,46) |
| InChIKey | ROOKGDKUAHLUEH-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 167.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.91 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|