C38H56N3O9P — CID 59801779
[17-[3-[3-[(3-amino-2-hydroxy-6-methoxybenzoyl)amino]propylamino]-3-oxopropoxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] dipropan-2-yl phosphate (PubChem CID 59801779) has the molecular formula C38H56N3O9P and a molecular weight of 729.85 g/mol. Its IUPAC name is [17-[3-[3-[(3-amino-2-hydroxy-6-methoxybenzoyl)amino]propylamino]-3-oxopropoxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] dipropan-2-yl phosphate.
| Compound Name | [17-[3-[3-[(3-amino-2-hydroxy-6-methoxybenzoyl)amino]propylamino]-3-oxopropoxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] dipropan-2-yl phosphate |
|---|---|
| PubChem CID | 59801779 |
| Molecular Formula | C38H56N3O9P |
| Molecular Weight | 729.85 g/mol |
| Exact Mass | 729.38 |
| IUPAC Name | [17-[3-[3-[(3-amino-2-hydroxy-6-methoxybenzoyl)amino]propylamino]-3-oxopropoxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] dipropan-2-yl phosphate |
| SMILES | COc1ccc(N)c(O)c1C(=O)NCCCNC(=O)CCOC1CCC2C3CCc4cc(OP(=O)(OC(C)C)OC(C)C)ccc4C3CCC12C |
| InChI | InChI=1S/C38H56N3O9P/c1-23(2)48-51(45,49-24(3)4)50-26-9-11-27-25(22-26)8-10-29-28(27)16-18-38(5)30(29)12-15-33(38)47-21-17-34(42)40-19-7-20-41-37(44)35-32(46-6)14-13-31(39)36(35)43/h9,11,13-14,22-24,28-30,33,43H,7-8,10,12,15-21,39H2,1-6H3,(H,40,42)(H,41,44) |
| InChIKey | YYBWEERQDGZDHD-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 167.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.85 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|