C29H36N2O5 — CID 142026029
3-[[2-[(3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)oxy]acetyl]amino]-6-methoxy-2-methylbenzamide (PubChem CID 142026029) has the molecular formula C29H36N2O5 and a molecular weight of 492.62 g/mol. Its IUPAC name is 3-[[2-[(3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)oxy]acetyl]amino]-6-methoxy-2-methylbenzamide.
| Compound Name | 3-[[2-[(3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)oxy]acetyl]amino]-6-methoxy-2-methylbenzamide |
|---|---|
| PubChem CID | 142026029 |
| Molecular Formula | C29H36N2O5 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | 3-[[2-[(3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)oxy]acetyl]amino]-6-methoxy-2-methylbenzamide |
| SMILES | COc1ccc(NC(=O)COC2CCC3C4CCc5cc(O)ccc5C4CCC23C)c(C)c1C(N)=O |
| InChI | InChI=1S/C29H36N2O5/c1-16-23(9-10-24(35-3)27(16)28(30)34)31-26(33)15-36-25-11-8-22-21-6-4-17-14-18(32)5-7-19(17)20(21)12-13-29(22,25)2/h5,7,9-10,14,20-22,25,32H,4,6,8,11-13,15H2,1-3H3,(H2,30,34)(H,31,33) |
| InChIKey | SVYLROAAGBPARN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |