C28H33NO4 — CID 144774212
[(13S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 2-[(4-methylbenzoyl)amino]acetate (PubChem CID 144774212) has the molecular formula C28H33NO4 and a molecular weight of 447.58 g/mol. Its IUPAC name is [(13S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 2-[(4-methylbenzoyl)amino]acetate.
| Compound Name | [(13S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 2-[(4-methylbenzoyl)amino]acetate |
|---|---|
| PubChem CID | 144774212 |
| Molecular Formula | C28H33NO4 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | [(13S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 2-[(4-methylbenzoyl)amino]acetate |
| SMILES | Cc1ccc(C(=O)NCC(=O)O[C@H]2CCC3C4CCc5cc(O)ccc5C4CC[C@@]32C)cc1 |
| InChI | InChI=1S/C28H33NO4/c1-17-3-5-18(6-4-17)27(32)29-16-26(31)33-25-12-11-24-23-9-7-19-15-20(30)8-10-21(19)22(23)13-14-28(24,25)2/h3-6,8,10,15,22-25,30H,7,9,11-14,16H2,1-2H3,(H,29,32)/t22?,23?,24?,25-,28-/m0/s1 |
| InChIKey | WYBNCDUIDYUROI-RPJHMFOSSA-N |
| XLogP | 4.90 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |