C26H31NO6S — CID 123691663
(3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl) 2-(4-sulfamoylphenoxy)acetate (PubChem CID 123691663) has the molecular formula C26H31NO6S and a molecular weight of 485.60 g/mol. Its IUPAC name is (3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl) 2-(4-sulfamoylphenoxy)acetate.
| Compound Name | (3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl) 2-(4-sulfamoylphenoxy)acetate |
|---|---|
| PubChem CID | 123691663 |
| Molecular Formula | C26H31NO6S |
| Molecular Weight | 485.60 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | (3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl) 2-(4-sulfamoylphenoxy)acetate |
| SMILES | CC12CCC3c4ccc(O)cc4CCC3C1CCC2OC(=O)COc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C26H31NO6S/c1-26-13-12-21-20-9-3-17(28)14-16(20)2-8-22(21)23(26)10-11-24(26)33-25(29)15-32-18-4-6-19(7-5-18)34(27,30)31/h3-7,9,14,21-24,28H,2,8,10-13,15H2,1H3,(H2,27,30,31) |
| InChIKey | NAFDIPLJADQBJU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.60 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |