C31H40N2O6S — CID 123713145
(3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl) 5-[methyl-(4-sulfamoylbenzoyl)amino]pentanoate (PubChem CID 123713145) has the molecular formula C31H40N2O6S and a molecular weight of 568.74 g/mol. Its IUPAC name is (3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl) 5-[methyl-(4-sulfamoylbenzoyl)amino]pentanoate.
| Compound Name | (3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl) 5-[methyl-(4-sulfamoylbenzoyl)amino]pentanoate |
|---|---|
| PubChem CID | 123713145 |
| Molecular Formula | C31H40N2O6S |
| Molecular Weight | 568.74 g/mol |
| Exact Mass | 568.26 |
| IUPAC Name | (3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl) 5-[methyl-(4-sulfamoylbenzoyl)amino]pentanoate |
| SMILES | CN(CCCCC(=O)OC1CCC2C3CCc4cc(O)ccc4C3CCC12C)C(=O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C31H40N2O6S/c1-31-17-16-25-24-13-9-22(34)19-21(24)8-12-26(25)27(31)14-15-28(31)39-29(35)5-3-4-18-33(2)30(36)20-6-10-23(11-7-20)40(32,37)38/h6-7,9-11,13,19,25-28,34H,3-5,8,12,14-18H2,1-2H3,(H2,32,37,38) |
| InChIKey | MHVSNSPZBZLENG-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 127.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.74 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|