C29H36N2O6S — CID 123499824
[(13S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] (2S)-2-[methyl-(4-sulfamoylbenzoyl)amino]propanoate (PubChem CID 123499824) has the molecular formula C29H36N2O6S and a molecular weight of 540.68 g/mol. Its IUPAC name is [(13S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] (2S)-2-[methyl-(4-sulfamoylbenzoyl)amino]propanoate.
| Compound Name | [(13S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] (2S)-2-[methyl-(4-sulfamoylbenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 123499824 |
| Molecular Formula | C29H36N2O6S |
| Molecular Weight | 540.68 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | [(13S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] (2S)-2-[methyl-(4-sulfamoylbenzoyl)amino]propanoate |
| SMILES | C[C@@H](C(=O)O[C@H]1CCC2C3CCc4cc(O)ccc4C3CC[C@@]21C)N(C)C(=O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C29H36N2O6S/c1-17(31(3)27(33)18-4-8-21(9-5-18)38(30,35)36)28(34)37-26-13-12-25-24-10-6-19-16-20(32)7-11-22(19)23(24)14-15-29(25,26)2/h4-5,7-9,11,16-17,23-26,32H,6,10,12-15H2,1-3H3,(H2,30,35,36)/t17-,23?,24?,25?,26-,29-/m0/s1 |
| InChIKey | SIEGUXPULLLZLM-GVDZLOGUSA-N |
| XLogP | 3.97 |
| TPSA | 127.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.68 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |