C25H30O4S — CID 4028411
(3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl) 4-methylbenzenesulfonate (PubChem CID 4028411) has the molecular formula C25H30O4S and a molecular weight of 426.58 g/mol. Its IUPAC name is (3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl) 4-methylbenzenesulfonate.
| Compound Name | (3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 4028411 |
| Molecular Formula | C25H30O4S |
| Molecular Weight | 426.58 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | (3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2CCC3C4CCc5cc(O)ccc5C4CCC23C)cc1 |
| InChI | InChI=1S/C25H30O4S/c1-16-3-7-19(8-4-16)30(27,28)29-24-12-11-23-22-9-5-17-15-18(26)6-10-20(17)21(22)13-14-25(23,24)2/h3-4,6-8,10,15,21-24,26H,5,9,11-14H2,1-2H3 |
| InChIKey | FKBGHOIYIHEXNW-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.58 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|