C28H45NO4S — CID 58715312
[(13S,17R)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] N,N-dipentylsulfamate (PubChem CID 58715312) has the molecular formula C28H45NO4S and a molecular weight of 491.74 g/mol. Its IUPAC name is [(13S,17R)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] N,N-dipentylsulfamate.
| Compound Name | [(13S,17R)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] N,N-dipentylsulfamate |
|---|---|
| PubChem CID | 58715312 |
| Molecular Formula | C28H45NO4S |
| Molecular Weight | 491.74 g/mol |
| Exact Mass | 491.31 |
| IUPAC Name | [(13S,17R)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] N,N-dipentylsulfamate |
| SMILES | CCCCCN(CCCCC)S(=O)(=O)O[C@@H]1CCC2C3CCc4cc(O)ccc4C3CC[C@@]21C |
| InChI | InChI=1S/C28H45NO4S/c1-4-6-8-18-29(19-9-7-5-2)34(31,32)33-27-15-14-26-25-12-10-21-20-22(30)11-13-23(21)24(25)16-17-28(26,27)3/h11,13,20,24-27,30H,4-10,12,14-19H2,1-3H3/t24?,25?,26?,27-,28+/m1/s1 |
| InChIKey | KDFSCKYMWHTXNH-LPJFGIBUSA-N |
| XLogP | 6.56 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.74 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|