C28H36O5S — CID 3896627
2-[(3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)oxy]ethyl 4-methylbenzenesulfonate (PubChem CID 3896627) has the molecular formula C28H36O5S and a molecular weight of 484.66 g/mol. Its IUPAC name is 2-[(3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)oxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[(3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)oxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 3896627 |
| Molecular Formula | C28H36O5S |
| Molecular Weight | 484.66 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | 2-[(3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)oxy]ethyl 4-methylbenzenesulfonate |
| SMILES | COc1ccc2c(c1)CCC1C2CCC2(C)C(OCCOS(=O)(=O)c3ccc(C)cc3)CCC12 |
| InChI | InChI=1S/C28H36O5S/c1-19-4-8-22(9-5-19)34(29,30)33-17-16-32-27-13-12-26-25-10-6-20-18-21(31-3)7-11-23(20)24(25)14-15-28(26,27)2/h4-5,7-9,11,18,24-27H,6,10,12-17H2,1-3H3 |
| InChIKey | ZZLFESCXYBWSOF-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.66 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|