C26H32O4S — CID 94036772
[(8S,9R,13S,14S,17S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 4-methylbenzenesulfonate (PubChem CID 94036772) has the molecular formula C26H32O4S and a molecular weight of 440.61 g/mol. Its IUPAC name is [(8S,9R,13S,14S,17S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 4-methylbenzenesulfonate.
| Compound Name | [(8S,9R,13S,14S,17S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 94036772 |
| Molecular Formula | C26H32O4S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | [(8S,9R,13S,14S,17S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 4-methylbenzenesulfonate |
| SMILES | COc1ccc2c(c1)CC[C@H]1[C@H]2CC[C@]2(C)[C@@H](OS(=O)(=O)c3ccc(C)cc3)CC[C@@H]12 |
| InChI | InChI=1S/C26H32O4S/c1-17-4-8-20(9-5-17)31(27,28)30-25-13-12-24-23-10-6-18-16-19(29-3)7-11-21(18)22(23)14-15-26(24,25)2/h4-5,7-9,11,16,22-25H,6,10,12-15H2,1-3H3/t22-,23-,24-,25-,26-/m0/s1 |
| InChIKey | ZJUABQDERHSYQM-LROMGURASA-N |
| XLogP | 5.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|