C34H41NO5S — CID 11801271
[(1S,3S,4aS,4bR,10bS,12aS)-8-methoxy-1-(2-methoxyanilino)-12a-methyl-2,3,4,4a,4b,5,6,10b,11,12-decahydro-1H-chrysen-3-yl] 4-methylbenzenesulfonate (PubChem CID 11801271) has the molecular formula C34H41NO5S and a molecular weight of 575.77 g/mol. Its IUPAC name is [(1S,3S,4aS,4bR,10bS,12aS)-8-methoxy-1-(2-methoxyanilino)-12a-methyl-2,3,4,4a,4b,5,6,10b,11,12-decahydro-1H-chrysen-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [(1S,3S,4aS,4bR,10bS,12aS)-8-methoxy-1-(2-methoxyanilino)-12a-methyl-2,3,4,4a,4b,5,6,10b,11,12-decahydro-1H-chrysen-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11801271 |
| Molecular Formula | C34H41NO5S |
| Molecular Weight | 575.77 g/mol |
| Exact Mass | 575.27 |
| IUPAC Name | [(1S,3S,4aS,4bR,10bS,12aS)-8-methoxy-1-(2-methoxyanilino)-12a-methyl-2,3,4,4a,4b,5,6,10b,11,12-decahydro-1H-chrysen-3-yl] 4-methylbenzenesulfonate |
| SMILES | COc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](Nc3ccccc3OC)C[C@@H](OS(=O)(=O)c3ccc(C)cc3)C[C@@H]12 |
| InChI | InChI=1S/C34H41NO5S/c1-22-9-13-26(14-10-22)41(36,37)40-25-20-30-29-15-11-23-19-24(38-3)12-16-27(23)28(29)17-18-34(30,2)33(21-25)35-31-7-5-6-8-32(31)39-4/h5-10,12-14,16,19,25,28-30,33,35H,11,15,17-18,20-21H2,1-4H3/t25-,28+,29+,30-,33-,34-/m0/s1 |
| InChIKey | UQDFFBMOWXTPPE-MOIOHTBFSA-N |
| XLogP | 7.12 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.77 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|