C27H34ClNO2 — CID 10575086
(1S,3S,4aS,4bR,10bS,12aS)-3-chloro-8-methoxy-N-(2-methoxyphenyl)-12a-methyl-2,3,4,4a,4b,5,6,10b,11,12-decahydro-1H-chrysen-1-amine (PubChem CID 10575086) has the molecular formula C27H34ClNO2 and a molecular weight of 440.03 g/mol. Its IUPAC name is (1S,3S,4aS,4bR,10bS,12aS)-3-chloro-8-methoxy-N-(2-methoxyphenyl)-12a-methyl-2,3,4,4a,4b,5,6,10b,11,12-decahydro-1H-chrysen-1-amine.
| Compound Name | (1S,3S,4aS,4bR,10bS,12aS)-3-chloro-8-methoxy-N-(2-methoxyphenyl)-12a-methyl-2,3,4,4a,4b,5,6,10b,11,12-decahydro-1H-chrysen-1-amine |
|---|---|
| PubChem CID | 10575086 |
| Molecular Formula | C27H34ClNO2 |
| Molecular Weight | 440.03 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | (1S,3S,4aS,4bR,10bS,12aS)-3-chloro-8-methoxy-N-(2-methoxyphenyl)-12a-methyl-2,3,4,4a,4b,5,6,10b,11,12-decahydro-1H-chrysen-1-amine |
| SMILES | COc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](Nc3ccccc3OC)C[C@@H](Cl)C[C@@H]12 |
| InChI | InChI=1S/C27H34ClNO2/c1-27-13-12-21-20-11-9-19(30-2)14-17(20)8-10-22(21)23(27)15-18(28)16-26(27)29-24-6-4-5-7-25(24)31-3/h4-7,9,11,14,18,21-23,26,29H,8,10,12-13,15-16H2,1-3H3/t18-,21+,22+,23-,26-,27-/m0/s1 |
| InChIKey | SXCOTFDBBJHGJB-HNDGBJONSA-N |
| XLogP | 6.65 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.03 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|