C26H31FN2O3 — CID 102469185
(1R,3R,4aS,4bR,10bS,12aR)-3-fluoro-8-methoxy-12a-methyl-N-(4-nitrophenyl)-2,3,4,4a,4b,5,6,10b,11,12-decahydro-1H-chrysen-1-amine (PubChem CID 102469185) has the molecular formula C26H31FN2O3 and a molecular weight of 438.54 g/mol. Its IUPAC name is (1R,3R,4aS,4bR,10bS,12aR)-3-fluoro-8-methoxy-12a-methyl-N-(4-nitrophenyl)-2,3,4,4a,4b,5,6,10b,11,12-decahydro-1H-chrysen-1-amine.
| Compound Name | (1R,3R,4aS,4bR,10bS,12aR)-3-fluoro-8-methoxy-12a-methyl-N-(4-nitrophenyl)-2,3,4,4a,4b,5,6,10b,11,12-decahydro-1H-chrysen-1-amine |
|---|---|
| PubChem CID | 102469185 |
| Molecular Formula | C26H31FN2O3 |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | (1R,3R,4aS,4bR,10bS,12aR)-3-fluoro-8-methoxy-12a-methyl-N-(4-nitrophenyl)-2,3,4,4a,4b,5,6,10b,11,12-decahydro-1H-chrysen-1-amine |
| SMILES | COc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H](Nc3ccc([N+](=O)[O-])cc3)C[C@H](F)C[C@@H]12 |
| InChI | InChI=1S/C26H31FN2O3/c1-26-12-11-22-21-10-8-20(32-2)13-16(21)3-9-23(22)24(26)14-17(27)15-25(26)28-18-4-6-19(7-5-18)29(30)31/h4-8,10,13,17,22-25,28H,3,9,11-12,14-15H2,1-2H3/t17-,22-,23-,24+,25-,26-/m1/s1 |
| InChIKey | MGJDVNOELLYMPG-NGCBZFRPSA-N |
| XLogP | 6.28 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|