C25H30ClNO — CID 67727065
(8R,9S,13S,14S,17S)-N-(4-chlorophenyl)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-amine (PubChem CID 67727065) has the molecular formula C25H30ClNO and a molecular weight of 395.97 g/mol. Its IUPAC name is (8R,9S,13S,14S,17S)-N-(4-chlorophenyl)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-amine.
| Compound Name | (8R,9S,13S,14S,17S)-N-(4-chlorophenyl)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-amine |
|---|---|
| PubChem CID | 67727065 |
| Molecular Formula | C25H30ClNO |
| Molecular Weight | 395.97 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | (8R,9S,13S,14S,17S)-N-(4-chlorophenyl)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-amine |
| SMILES | COc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](Nc3ccc(Cl)cc3)CC[C@@H]12 |
| InChI | InChI=1S/C25H30ClNO/c1-25-14-13-21-20-10-8-19(28-2)15-16(20)3-9-22(21)23(25)11-12-24(25)27-18-6-4-17(26)5-7-18/h4-8,10,15,21-24,27H,3,9,11-14H2,1-2H3/t21-,22-,23+,24+,25+/m1/s1 |
| InChIKey | ZZZMEJKHJFDNSG-VAFBSOEGSA-N |
| XLogP | 6.69 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.97 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |