C29H50N4O — CID 67847858
N-(3-aminopropyl)-N'-[3-[[(8R,9S,13S,14S,17S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]amino]propyl]butane-1,4-diamine (PubChem CID 67847858) has the molecular formula C29H50N4O and a molecular weight of 470.75 g/mol. Its IUPAC name is N-(3-aminopropyl)-N'-[3-[[(8R,9S,13S,14S,17S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]amino]propyl]butane-1,4-diamine.
| Compound Name | N-(3-aminopropyl)-N'-[3-[[(8R,9S,13S,14S,17S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]amino]propyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 67847858 |
| Molecular Formula | C29H50N4O |
| Molecular Weight | 470.75 g/mol |
| Exact Mass | 470.40 |
| IUPAC Name | N-(3-aminopropyl)-N'-[3-[[(8R,9S,13S,14S,17S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]amino]propyl]butane-1,4-diamine |
| SMILES | COc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](NCCCNCCCCNCCCN)CC[C@@H]12 |
| InChI | InChI=1S/C29H50N4O/c1-29-14-13-25-24-10-8-23(34-2)21-22(24)7-9-26(25)27(29)11-12-28(29)33-20-6-19-32-17-4-3-16-31-18-5-15-30/h8,10,21,25-28,31-33H,3-7,9,11-20,30H2,1-2H3/t25-,26-,27+,28+,29+/m1/s1 |
| InChIKey | ILKYAUYRZIPYFS-PNHLWVRCSA-N |
| XLogP | 4.21 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.75 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|