C25H41N3O — CID 18638574
N'-[3-[[(8R,9S,13S,14S,17S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]amino]propyl]propane-1,3-diamine (PubChem CID 18638574) has the molecular formula C25H41N3O and a molecular weight of 399.62 g/mol. Its IUPAC name is N'-[3-[[(8R,9S,13S,14S,17S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]amino]propyl]propane-1,3-diamine.
| Compound Name | N'-[3-[[(8R,9S,13S,14S,17S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]amino]propyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 18638574 |
| Molecular Formula | C25H41N3O |
| Molecular Weight | 399.62 g/mol |
| Exact Mass | 399.32 |
| IUPAC Name | N'-[3-[[(8R,9S,13S,14S,17S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]amino]propyl]propane-1,3-diamine |
| SMILES | COc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](NCCCNCCCN)CC[C@@H]12 |
| InChI | InChI=1S/C25H41N3O/c1-25-12-11-21-20-8-6-19(29-2)17-18(20)5-7-22(21)23(25)9-10-24(25)28-16-4-15-27-14-3-13-26/h6,8,17,21-24,27-28H,3-5,7,9-16,26H2,1-2H3/t21-,22-,23+,24+,25+/m1/s1 |
| InChIKey | GHQJKFNXKSAVKA-VAFBSOEGSA-N |
| XLogP | 3.84 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.62 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|