C31H42N4O5 — CID 18654149
N'-(2,4-dinitrophenyl)-N-[(13S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]hexane-1,6-diamine (PubChem CID 18654149) has the molecular formula C31H42N4O5 and a molecular weight of 550.70 g/mol. Its IUPAC name is N'-(2,4-dinitrophenyl)-N-[(13S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]hexane-1,6-diamine.
| Compound Name | N'-(2,4-dinitrophenyl)-N-[(13S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]hexane-1,6-diamine |
|---|---|
| PubChem CID | 18654149 |
| Molecular Formula | C31H42N4O5 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.32 |
| IUPAC Name | N'-(2,4-dinitrophenyl)-N-[(13S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]hexane-1,6-diamine |
| SMILES | COc1ccc2c(c1)CCC1C2CC[C@]2(C)C(NCCCCCCNc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])CCC12 |
| InChI | InChI=1S/C31H42N4O5/c1-31-16-15-25-24-11-9-23(40-2)19-21(24)7-10-26(25)27(31)12-14-30(31)33-18-6-4-3-5-17-32-28-13-8-22(34(36)37)20-29(28)35(38)39/h8-9,11,13,19-20,25-27,30,32-33H,3-7,10,12,14-18H2,1-2H3/t25?,26?,27?,30?,31-/m0/s1 |
| InChIKey | NYDZLUJNGUOOCR-HMPIOLDBSA-N |
| XLogP | 7.00 |
| TPSA | 119.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|