C31H45N3O3 — CID 67847867
1-[6-[[(8R,9S,13S,14S)-3-(3-aminopropoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]amino]hexyl]pyrrole-2,5-dione (PubChem CID 67847867) has the molecular formula C31H45N3O3 and a molecular weight of 507.72 g/mol. Its IUPAC name is 1-[6-[[(8R,9S,13S,14S)-3-(3-aminopropoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]amino]hexyl]pyrrole-2,5-dione.
| Compound Name | 1-[6-[[(8R,9S,13S,14S)-3-(3-aminopropoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]amino]hexyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 67847867 |
| Molecular Formula | C31H45N3O3 |
| Molecular Weight | 507.72 g/mol |
| Exact Mass | 507.35 |
| IUPAC Name | 1-[6-[[(8R,9S,13S,14S)-3-(3-aminopropoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]amino]hexyl]pyrrole-2,5-dione |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OCCCN)cc4CC[C@H]3[C@@H]1CCC2NCCCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C31H45N3O3/c1-31-16-15-25-24-10-8-23(37-20-6-17-32)21-22(24)7-9-26(25)27(31)11-12-28(31)33-18-4-2-3-5-19-34-29(35)13-14-30(34)36/h8,10,13-14,21,25-28,33H,2-7,9,11-12,15-20,32H2,1H3/t25-,26-,27+,28?,31+/m1/s1 |
| InChIKey | OBZKWEODGKJKHA-LCFCZSBUSA-N |
| XLogP | 4.71 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.72 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|