C26H39NO2 — CID 99934933
(8S,9R,13S,14R)-3-[6-(dimethylamino)hexoxy]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 99934933) has the molecular formula C26H39NO2 and a molecular weight of 397.60 g/mol. Its IUPAC name is (8S,9R,13S,14R)-3-[6-(dimethylamino)hexoxy]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8S,9R,13S,14R)-3-[6-(dimethylamino)hexoxy]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 99934933 |
| Molecular Formula | C26H39NO2 |
| Molecular Weight | 397.60 g/mol |
| Exact Mass | 397.30 |
| IUPAC Name | (8S,9R,13S,14R)-3-[6-(dimethylamino)hexoxy]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | CN(C)CCCCCCOc1ccc2c(c1)CC[C@@H]1[C@H]3CCC(=O)[C@@]3(C)CC[C@@H]21 |
| InChI | InChI=1S/C26H39NO2/c1-26-15-14-22-21-11-9-20(29-17-7-5-4-6-16-27(2)3)18-19(21)8-10-23(22)24(26)12-13-25(26)28/h9,11,18,22-24H,4-8,10,12-17H2,1-3H3/t22-,23-,24+,26-/m0/s1 |
| InChIKey | PMGFTIDUJNLRSY-SRNFOCHHSA-N |
| XLogP | 5.61 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.60 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|