C24H30F4O2 — CID 122376622
(8R,9S,13S,14S)-13-methyl-3-(4,6,6,6-tetrafluorohexoxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 122376622) has the molecular formula C24H30F4O2 and a molecular weight of 426.49 g/mol. Its IUPAC name is (8R,9S,13S,14S)-13-methyl-3-(4,6,6,6-tetrafluorohexoxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S)-13-methyl-3-(4,6,6,6-tetrafluorohexoxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 122376622 |
| Molecular Formula | C24H30F4O2 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | (8R,9S,13S,14S)-13-methyl-3-(4,6,6,6-tetrafluorohexoxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OCCCC(F)CC(F)(F)F)cc4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C24H30F4O2/c1-23-11-10-19-18-7-5-17(30-12-2-3-16(25)14-24(26,27)28)13-15(18)4-6-20(19)21(23)8-9-22(23)29/h5,7,13,16,19-21H,2-4,6,8-12,14H2,1H3/t16?,19-,20-,21+,23+/m1/s1 |
| InChIKey | QJMNKBAJCLBPCZ-FINBKCRCSA-N |
| XLogP | 6.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|