C22H29ClO2 — CID 166607307
(8R,9S,13S,14S)-3-(4-chlorobutoxy)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 166607307) has the molecular formula C22H29ClO2 and a molecular weight of 360.93 g/mol. Its IUPAC name is (8R,9S,13S,14S)-3-(4-chlorobutoxy)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S)-3-(4-chlorobutoxy)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 166607307 |
| Molecular Formula | C22H29ClO2 |
| Molecular Weight | 360.93 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | (8R,9S,13S,14S)-3-(4-chlorobutoxy)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OCCCCCl)cc4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C22H29ClO2/c1-22-11-10-18-17-7-5-16(25-13-3-2-12-23)14-15(17)4-6-19(18)20(22)8-9-21(22)24/h5,7,14,18-20H,2-4,6,8-13H2,1H3/t18-,19-,20+,22+/m1/s1 |
| InChIKey | FGYGFRICGZJBLW-JBPLPALLSA-N |
| XLogP | 5.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.93 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|