C24H29F3O3 — CID 171341990
[(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] 6,6,6-trifluorohexanoate (PubChem CID 171341990) has the molecular formula C24H29F3O3 and a molecular weight of 422.49 g/mol. Its IUPAC name is [(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] 6,6,6-trifluorohexanoate.
| Compound Name | [(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] 6,6,6-trifluorohexanoate |
|---|---|
| PubChem CID | 171341990 |
| Molecular Formula | C24H29F3O3 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | [(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] 6,6,6-trifluorohexanoate |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OC(=O)CCCCC(F)(F)F)cc4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C24H29F3O3/c1-23-13-11-18-17-8-6-16(30-22(29)4-2-3-12-24(25,26)27)14-15(17)5-7-19(18)20(23)9-10-21(23)28/h6,8,14,18-20H,2-5,7,9-13H2,1H3/t18-,19-,20+,23+/m1/s1 |
| InChIKey | LWEMEUZXXFNERP-UGTOYMOASA-N |
| XLogP | 6.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|