C29H34O5S — CID 164667806
[(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] 5-(benzenesulfonyl)pentanoate (PubChem CID 164667806) has the molecular formula C29H34O5S and a molecular weight of 494.65 g/mol. Its IUPAC name is [(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] 5-(benzenesulfonyl)pentanoate.
| Compound Name | [(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] 5-(benzenesulfonyl)pentanoate |
|---|---|
| PubChem CID | 164667806 |
| Molecular Formula | C29H34O5S |
| Molecular Weight | 494.65 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | [(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] 5-(benzenesulfonyl)pentanoate |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OC(=O)CCCCS(=O)(=O)c5ccccc5)cc4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C29H34O5S/c1-29-17-16-24-23-13-11-21(19-20(23)10-12-25(24)26(29)14-15-27(29)30)34-28(31)9-5-6-18-35(32,33)22-7-3-2-4-8-22/h2-4,7-8,11,13,19,24-26H,5-6,9-10,12,14-18H2,1H3/t24-,25-,26+,29+/m1/s1 |
| InChIKey | NMDHWWRLPYIFJB-JMDODURXSA-N |
| XLogP | 5.66 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.65 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|