C28H39NO3 — CID 3279509
(13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl) 3-(3,3-dimethylpiperidin-1-yl)propanoate (PubChem CID 3279509) has the molecular formula C28H39NO3 and a molecular weight of 437.62 g/mol. Its IUPAC name is (13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl) 3-(3,3-dimethylpiperidin-1-yl)propanoate.
| Compound Name | (13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl) 3-(3,3-dimethylpiperidin-1-yl)propanoate |
|---|---|
| PubChem CID | 3279509 |
| Molecular Formula | C28H39NO3 |
| Molecular Weight | 437.62 g/mol |
| Exact Mass | 437.29 |
| IUPAC Name | (13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl) 3-(3,3-dimethylpiperidin-1-yl)propanoate |
| SMILES | CC1(C)CCCN(CCC(=O)Oc2ccc3c(c2)CCC2C3CCC3(C)C(=O)CCC23)C1 |
| InChI | InChI=1S/C28H39NO3/c1-27(2)13-4-15-29(18-27)16-12-26(31)32-20-6-8-21-19(17-20)5-7-23-22(21)11-14-28(3)24(23)9-10-25(28)30/h6,8,17,22-24H,4-5,7,9-16,18H2,1-3H3 |
| InChIKey | KDYPCXIDBCQDOZ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.62 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|