C24H30O5 — CID 178072249
6-[[(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]oxy]-6-oxohexanoic acid (PubChem CID 178072249) has the molecular formula C24H30O5 and a molecular weight of 398.50 g/mol. Its IUPAC name is 6-[[(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]oxy]-6-oxohexanoic acid.
| Compound Name | 6-[[(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]oxy]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 178072249 |
| Molecular Formula | C24H30O5 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 6-[[(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]oxy]-6-oxohexanoic acid |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OC(=O)CCCCC(=O)O)cc4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C24H30O5/c1-24-13-12-18-17-9-7-16(29-23(28)5-3-2-4-22(26)27)14-15(17)6-8-19(18)20(24)10-11-21(24)25/h7,9,14,18-20H,2-6,8,10-13H2,1H3,(H,26,27)/t18-,19-,20+,24+/m1/s1 |
| InChIKey | BZOCQOBVWFZOAV-FDGPYGQJSA-N |
| XLogP | 4.66 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|