C40H66O3 — CID 143766004
ethane;(13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl) (Z)-octadec-9-enoate (PubChem CID 143766004) has the molecular formula C40H66O3 and a molecular weight of 594.97 g/mol. Its IUPAC name is ethane;(13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl) (Z)-octadec-9-enoate.
| Compound Name | ethane;(13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl) (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 143766004 |
| Molecular Formula | C40H66O3 |
| Molecular Weight | 594.97 g/mol |
| Exact Mass | 594.50 |
| IUPAC Name | ethane;(13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl) (Z)-octadec-9-enoate |
| SMILES | CC.CC.CCCCCCCC/C=C\CCCCCCCC(=O)Oc1ccc2c(c1)CCC1C2CCC2(C)C(=O)CCC12 |
| InChI | InChI=1S/C36H54O3.2C2H6/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-35(38)39-29-20-22-30-28(27-29)19-21-32-31(30)25-26-36(2)33(32)23-24-34(36)37;2*1-2/h10-11,20,22,27,31-33H,3-9,12-19,21,23-26H2,1-2H3;2*1-2H3/b11-10-;; |
| InChIKey | FNXVWSTYEGDODT-PQBRBDCOSA-N |
| XLogP | 12.11 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.97 |
| LogP ≤ 5 | 12.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|