C23H29ClO2 — CID 54433244
[(8S,9S,13S,14S)-17-(chloromethylidene)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] butanoate (PubChem CID 54433244) has the molecular formula C23H29ClO2 and a molecular weight of 372.94 g/mol. Its IUPAC name is [(8S,9S,13S,14S)-17-(chloromethylidene)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] butanoate.
| Compound Name | [(8S,9S,13S,14S)-17-(chloromethylidene)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] butanoate |
|---|---|
| PubChem CID | 54433244 |
| Molecular Formula | C23H29ClO2 |
| Molecular Weight | 372.94 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | [(8S,9S,13S,14S)-17-(chloromethylidene)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] butanoate |
| SMILES | CCCC(=O)Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)C(=CCl)CC[C@@H]12 |
| InChI | InChI=1S/C23H29ClO2/c1-3-4-22(25)26-17-7-9-18-15(13-17)5-8-20-19(18)11-12-23(2)16(14-24)6-10-21(20)23/h7,9,13-14,19-21H,3-6,8,10-12H2,1-2H3/t19-,20-,21+,23-/m1/s1 |
| InChIKey | WIYZEBOTIHXAMM-CUDBPUKSSA-N |
| XLogP | 6.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.94 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|