C21H27BrO2 — CID 70547764
[(8S,9S,13S,14S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] 3-bromopropanoate (PubChem CID 70547764) has the molecular formula C21H27BrO2 and a molecular weight of 391.35 g/mol. Its IUPAC name is [(8S,9S,13S,14S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] 3-bromopropanoate.
| Compound Name | [(8S,9S,13S,14S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] 3-bromopropanoate |
|---|---|
| PubChem CID | 70547764 |
| Molecular Formula | C21H27BrO2 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | [(8S,9S,13S,14S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] 3-bromopropanoate |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CCc3cc(OC(=O)CCBr)ccc3[C@H]1CC2 |
| InChI | InChI=1S/C21H27BrO2/c1-21-10-2-3-19(21)18-6-4-14-13-15(24-20(23)9-12-22)5-7-16(14)17(18)8-11-21/h5,7,13,17-19H,2-4,6,8-12H2,1H3/t17-,18-,19+,21+/m1/s1 |
| InChIKey | LEKGXJXPHAOUEA-BNDYYXHWSA-N |
| XLogP | 5.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|