C25H28O2 — CID 101456305
[(8S,9S,13S,14S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate (PubChem CID 101456305) has the molecular formula C25H28O2 and a molecular weight of 360.50 g/mol. Its IUPAC name is [(8S,9S,13S,14S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate.
| Compound Name | [(8S,9S,13S,14S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate |
|---|---|
| PubChem CID | 101456305 |
| Molecular Formula | C25H28O2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | [(8S,9S,13S,14S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CCc3cc(OC(=O)c4ccccc4)ccc3[C@H]1CC2 |
| InChI | InChI=1S/C25H28O2/c1-25-14-5-8-23(25)22-11-9-18-16-19(10-12-20(18)21(22)13-15-25)27-24(26)17-6-3-2-4-7-17/h2-4,6-7,10,12,16,21-23H,5,8-9,11,13-15H2,1H3/t21-,22-,23+,25+/m1/s1 |
| InChIKey | WJKSWYVJABYUPP-AHCIIZGASA-N |
| XLogP | 6.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|