C21H32OSi — CID 22296261
trimethyl-[[(8S,9S,13S,14S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxy]silane (PubChem CID 22296261) has the molecular formula C21H32OSi and a molecular weight of 328.57 g/mol. Its IUPAC name is trimethyl-[[(8S,9S,13S,14S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxy]silane.
| Compound Name | trimethyl-[[(8S,9S,13S,14S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxy]silane |
|---|---|
| PubChem CID | 22296261 |
| Molecular Formula | C21H32OSi |
| Molecular Weight | 328.57 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | trimethyl-[[(8S,9S,13S,14S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxy]silane |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CCc3cc(O[Si](C)(C)C)ccc3[C@H]1CC2 |
| InChI | InChI=1S/C21H32OSi/c1-21-12-5-6-20(21)19-9-7-15-14-16(22-23(2,3)4)8-10-17(15)18(19)11-13-21/h8,10,14,18-20H,5-7,9,11-13H2,1-4H3/t18-,19-,20+,21+/m1/s1 |
| InChIKey | FXRPWGRCNHJNJG-CGXNFDGLSA-N |
| XLogP | 6.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.57 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|