C18H24AcO — CID 22950890
actinium;13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 22950890) has the molecular formula C18H24AcO and a molecular weight of 483.39 g/mol. Its IUPAC name is actinium;13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | actinium;13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 22950890 |
| Molecular Formula | C18H24AcO |
| Molecular Weight | 483.39 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | actinium;13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC12CCCC1C1CCc3cc(O)ccc3C1CC2.[Ac] |
| InChI | InChI=1S/C18H24O.Ac/c1-18-9-2-3-17(18)16-6-4-12-11-13(19)5-7-14(12)15(16)8-10-18;/h5,7,11,15-17,19H,2-4,6,8-10H2,1H3; |
| InChIKey | AJROAZQBFWICHQ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.39 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |