C19H25Y- — CID 59676568
(13S)-3,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-2H-cyclopenta[a]phenanthren-2-ide;yttrium (PubChem CID 59676568) has the molecular formula C19H25Y- and a molecular weight of 342.32 g/mol. Its IUPAC name is (13S)-3,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-2H-cyclopenta[a]phenanthren-2-ide;yttrium.
| Compound Name | (13S)-3,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-2H-cyclopenta[a]phenanthren-2-ide;yttrium |
|---|---|
| PubChem CID | 59676568 |
| Molecular Formula | C19H25Y- |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | (13S)-3,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-2H-cyclopenta[a]phenanthren-2-ide;yttrium |
| SMILES | Cc1[c-]cc2c(c1)CCC1C2CC[C@]2(C)CCCC12.[Y] |
| InChI | InChI=1S/C19H25.Y/c1-13-5-7-15-14(12-13)6-8-17-16(15)9-11-19(2)10-3-4-18(17)19;/h7,12,16-18H,3-4,6,8-11H2,1-2H3;/q-1;/t16?,17?,18?,19-;/m0./s1 |
| InChIKey | JHGIEMIIWDQQRR-LNBFSHRSSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|