C23H36 — CID 142141832
ethane;(1R,2R,9R,12R)-9-methyltetracyclo[10.8.0.02,9.013,18]icosa-13,15,17-triene (PubChem CID 142141832) has the molecular formula C23H36 and a molecular weight of 312.54 g/mol. Its IUPAC name is ethane;(1R,2R,9R,12R)-9-methyltetracyclo[10.8.0.02,9.013,18]icosa-13,15,17-triene.
| Compound Name | ethane;(1R,2R,9R,12R)-9-methyltetracyclo[10.8.0.02,9.013,18]icosa-13,15,17-triene |
|---|---|
| PubChem CID | 142141832 |
| Molecular Formula | C23H36 |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.28 |
| IUPAC Name | ethane;(1R,2R,9R,12R)-9-methyltetracyclo[10.8.0.02,9.013,18]icosa-13,15,17-triene |
| SMILES | CC.C[C@]12CCCCCC[C@@H]1[C@H]1CCc3ccccc3[C@@H]1CC2 |
| InChI | InChI=1S/C21H30.C2H6/c1-21-14-7-3-2-4-10-20(21)19-12-11-16-8-5-6-9-17(16)18(19)13-15-21;1-2/h5-6,8-9,18-20H,2-4,7,10-15H2,1H3;1-2H3/t18-,19-,20+,21+;/m0./s1 |
| InChIKey | MBAKLTADKMCVMO-HRVFFBEBSA-N |
| XLogP | 7.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |