C19H26O — CID 168918043
17-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene (PubChem CID 168918043) has the molecular formula C19H26O and a molecular weight of 270.42 g/mol. Its IUPAC name is 17-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene.
| Compound Name | 17-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 168918043 |
| Molecular Formula | C19H26O |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | 17-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
| SMILES | COC1CCC2C3CCc4ccccc4C3CCC12C |
| InChI | InChI=1S/C19H26O/c1-19-12-11-15-14-6-4-3-5-13(14)7-8-16(15)17(19)9-10-18(19)20-2/h3-6,15-18H,7-12H2,1-2H3 |
| InChIKey | CGCMRPAWDKXAQS-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |