C20H26O3 — CID 140822304
[(13S,17S)-13-methyl-3-tritio-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 2-hydroxyacetate (PubChem CID 140822304) has the molecular formula C20H26O3 and a molecular weight of 316.43 g/mol. Its IUPAC name is [(13S,17S)-13-methyl-3-tritio-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 2-hydroxyacetate.
| Compound Name | [(13S,17S)-13-methyl-3-tritio-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 2-hydroxyacetate |
|---|---|
| PubChem CID | 140822304 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | [(13S,17S)-13-methyl-3-tritio-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 2-hydroxyacetate |
| SMILES | [3H]c1ccc2c(c1)CCC1C2CC[C@@]2(C)C1CC[C@@H]2OC(=O)CO |
| InChI | InChI=1S/C20H26O3/c1-20-11-10-15-14-5-3-2-4-13(14)6-7-16(15)17(20)8-9-18(20)23-19(22)12-21/h2-5,15-18,21H,6-12H2,1H3/t15?,16?,17?,18-,20-/m0/s1/i2T |
| InChIKey | LFNAQNDTIFMGCY-PUEAAPNSSA-N |
| XLogP | 3.45 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |