C26H40O4Si — CID 131741805
[(13S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 2-hydroxyacetate (PubChem CID 131741805) has the molecular formula C26H40O4Si and a molecular weight of 444.69 g/mol. Its IUPAC name is [(13S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 2-hydroxyacetate.
| Compound Name | [(13S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 2-hydroxyacetate |
|---|---|
| PubChem CID | 131741805 |
| Molecular Formula | C26H40O4Si |
| Molecular Weight | 444.69 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | [(13S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 2-hydroxyacetate |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc2c(c1)CCC1C2CC[C@@]2(C)C1CC[C@@H]2OC(=O)CO |
| InChI | InChI=1S/C26H40O4Si/c1-25(2,3)31(5,6)30-18-8-10-19-17(15-18)7-9-21-20(19)13-14-26(4)22(21)11-12-23(26)29-24(28)16-27/h8,10,15,20-23,27H,7,9,11-14,16H2,1-6H3/t20?,21?,22?,23-,26-/m0/s1 |
| InChIKey | TYJCCVLUZXTYPT-LAPMQGOMSA-N |
| XLogP | 5.83 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.69 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|