C26H40O2Si — CID 66959715
2-[3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]ethanol (PubChem CID 66959715) has the molecular formula C26H40O2Si and a molecular weight of 412.69 g/mol. Its IUPAC name is 2-[3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]ethanol.
| Compound Name | 2-[3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]ethanol |
|---|---|
| PubChem CID | 66959715 |
| Molecular Formula | C26H40O2Si |
| Molecular Weight | 412.69 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | 2-[3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]ethanol |
| SMILES | CC12CCC3c4ccc(O[Si](C)(C)C(C)(C)C)cc4CCC3C1CCC2=CCO |
| InChI | InChI=1S/C26H40O2Si/c1-25(2,3)29(5,6)28-20-9-11-21-18(17-20)7-10-23-22(21)13-15-26(4)19(14-16-27)8-12-24(23)26/h9,11,14,17,22-24,27H,7-8,10,12-13,15-16H2,1-6H3 |
| InChIKey | PLSCCUXRRYVQCS-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.69 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|