C25H38O2Si — CID 15713351
tert-butyl-[[(8R,9S,13S,14S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-yl]oxy]-dimethylsilane (PubChem CID 15713351) has the molecular formula C25H38O2Si and a molecular weight of 398.66 g/mol. Its IUPAC name is tert-butyl-[[(8R,9S,13S,14S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(8R,9S,13S,14S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 15713351 |
| Molecular Formula | C25H38O2Si |
| Molecular Weight | 398.66 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | tert-butyl-[[(8R,9S,13S,14S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-yl]oxy]-dimethylsilane |
| SMILES | COc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)C(O[Si](C)(C)C(C)(C)C)=CC[C@@H]12 |
| InChI | InChI=1S/C25H38O2Si/c1-24(2,3)28(6,7)27-23-13-12-22-21-10-8-17-16-18(26-5)9-11-19(17)20(21)14-15-25(22,23)4/h9,11,13,16,20-22H,8,10,12,14-15H2,1-7H3/t20-,21-,22+,25+/m1/s1 |
| InChIKey | QXOUBCRZQWSIAF-APDHKMKFSA-N |
| XLogP | 7.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.66 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|