C23H35N2O3P — CID 15858978
N-[dimethylamino-[[(8R,9S,13S,14S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-yl]oxy]phosphoryl]-N-methylmethanamine (PubChem CID 15858978) has the molecular formula C23H35N2O3P and a molecular weight of 418.52 g/mol. Its IUPAC name is N-[dimethylamino-[[(8R,9S,13S,14S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-yl]oxy]phosphoryl]-N-methylmethanamine.
| Compound Name | N-[dimethylamino-[[(8R,9S,13S,14S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-yl]oxy]phosphoryl]-N-methylmethanamine |
|---|---|
| PubChem CID | 15858978 |
| Molecular Formula | C23H35N2O3P |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | N-[dimethylamino-[[(8R,9S,13S,14S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-yl]oxy]phosphoryl]-N-methylmethanamine |
| SMILES | COc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)C(OP(=O)(N(C)C)N(C)C)=CC[C@@H]12 |
| InChI | InChI=1S/C23H35N2O3P/c1-23-14-13-19-18-10-8-17(27-6)15-16(18)7-9-20(19)21(23)11-12-22(23)28-29(26,24(2)3)25(4)5/h8,10,12,15,19-21H,7,9,11,13-14H2,1-6H3/t19-,20-,21+,23+/m1/s1 |
| InChIKey | HWXJDYCRRWNLMI-JFYQVNSESA-N |
| XLogP | 5.29 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|