C26H37NOSi — CID 70793879
2-[(13S)-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]acetonitrile (PubChem CID 70793879) has the molecular formula C26H37NOSi and a molecular weight of 407.67 g/mol. Its IUPAC name is 2-[(13S)-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]acetonitrile.
| Compound Name | 2-[(13S)-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]acetonitrile |
|---|---|
| PubChem CID | 70793879 |
| Molecular Formula | C26H37NOSi |
| Molecular Weight | 407.67 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | 2-[(13S)-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]acetonitrile |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc2c(c1)CCC1C2CC[C@]2(C)C(=CC#N)CCC12 |
| InChI | InChI=1S/C26H37NOSi/c1-25(2,3)29(5,6)28-20-9-11-21-18(17-20)7-10-23-22(21)13-15-26(4)19(14-16-27)8-12-24(23)26/h9,11,14,17,22-24H,7-8,10,12-13,15H2,1-6H3/t22?,23?,24?,26-/m1/s1 |
| InChIKey | YKQIHVCGUXQNGX-KHYUUSJJSA-N |
| XLogP | 7.38 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.67 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|