C27H39NO2Si — CID 70793881
2-[(13S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]acetonitrile (PubChem CID 70793881) has the molecular formula C27H39NO2Si and a molecular weight of 437.70 g/mol. Its IUPAC name is 2-[(13S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]acetonitrile.
| Compound Name | 2-[(13S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]acetonitrile |
|---|---|
| PubChem CID | 70793881 |
| Molecular Formula | C27H39NO2Si |
| Molecular Weight | 437.70 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | 2-[(13S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]acetonitrile |
| SMILES | COc1cc2c(cc1O[Si](C)(C)C(C)(C)C)CCC1C2CC[C@]2(C)C(=CC#N)CCC12 |
| InChI | InChI=1S/C27H39NO2Si/c1-26(2,3)31(6,7)30-25-16-18-8-10-21-20(22(18)17-24(25)29-5)12-14-27(4)19(13-15-28)9-11-23(21)27/h13,16-17,20-21,23H,8-12,14H2,1-7H3/t20?,21?,23?,27-/m1/s1 |
| InChIKey | UKMRVNVCPHIMIO-ISINKVRMSA-N |
| XLogP | 7.39 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.70 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|