C29H40N2OSi — CID 91420796
2-[(8S,9S,13S,14S)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]-2-isocyanoacetonitrile (PubChem CID 91420796) has the molecular formula C29H40N2OSi and a molecular weight of 460.74 g/mol. Its IUPAC name is 2-[(8S,9S,13S,14S)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]-2-isocyanoacetonitrile.
| Compound Name | 2-[(8S,9S,13S,14S)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 91420796 |
| Molecular Formula | C29H40N2OSi |
| Molecular Weight | 460.74 g/mol |
| Exact Mass | 460.29 |
| IUPAC Name | 2-[(8S,9S,13S,14S)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]C(C#N)=C1CC[C@H]2[C@@H]3CCc4cc(O[Si](C)(C)C(C)(C)C)c(CC)cc4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H40N2OSi/c1-9-19-16-23-20(17-27(19)32-33(7,8)28(2,3)4)10-11-22-21(23)14-15-29(5)24(22)12-13-25(29)26(18-30)31-6/h16-17,21-22,24H,9-15H2,1-5,7-8H3/t21-,22+,24-,29-/m0/s1 |
| InChIKey | OILSTNWAODORIO-JJYHCBOZSA-N |
| XLogP | 8.19 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.74 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|