C32H54O3Si2 — CID 10030264
1-[(13S,17S)-3,17-bis[[tert-butyl(dimethyl)silyl]oxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-yl]ethanone (PubChem CID 10030264) has the molecular formula C32H54O3Si2 and a molecular weight of 542.95 g/mol. Its IUPAC name is 1-[(13S,17S)-3,17-bis[[tert-butyl(dimethyl)silyl]oxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-yl]ethanone.
| Compound Name | 1-[(13S,17S)-3,17-bis[[tert-butyl(dimethyl)silyl]oxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-yl]ethanone |
|---|---|
| PubChem CID | 10030264 |
| Molecular Formula | C32H54O3Si2 |
| Molecular Weight | 542.95 g/mol |
| Exact Mass | 542.36 |
| IUPAC Name | 1-[(13S,17S)-3,17-bis[[tert-butyl(dimethyl)silyl]oxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-yl]ethanone |
| SMILES | CC(=O)c1cc2c(cc1O[Si](C)(C)C(C)(C)C)CCC1C2CC[C@@]2(C)C1CC[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H54O3Si2/c1-21(33)25-20-26-22(19-28(25)34-36(9,10)30(2,3)4)13-14-24-23(26)17-18-32(8)27(24)15-16-29(32)35-37(11,12)31(5,6)7/h19-20,23-24,27,29H,13-18H2,1-12H3/t23?,24?,27?,29-,32-/m0/s1 |
| InChIKey | HKCXODMENXNAPN-AZUDAIFISA-N |
| XLogP | 9.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.95 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|