C20H26O3 — CID 11130838
1-[(8R,9S,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-yl]ethanone (PubChem CID 11130838) has the molecular formula C20H26O3 and a molecular weight of 314.42 g/mol. Its IUPAC name is 1-[(8R,9S,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-yl]ethanone.
| Compound Name | 1-[(8R,9S,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-yl]ethanone |
|---|---|
| PubChem CID | 11130838 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | 1-[(8R,9S,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-yl]ethanone |
| SMILES | CC(=O)c1cc2c(cc1O)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 |
| InChI | InChI=1S/C20H26O3/c1-11(21)15-10-16-12(9-18(15)22)3-4-14-13(16)7-8-20(2)17(14)5-6-19(20)23/h9-10,13-14,17,19,22-23H,3-8H2,1-2H3/t13-,14+,17-,19-,20-/m0/s1 |
| InChIKey | KAJWCJZDMSIJDK-RVIPTACNSA-N |
| XLogP | 3.81 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |