C22H30O4 — CID 90915606
methyl 3-[(13S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-yl]propanoate (PubChem CID 90915606) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is methyl 3-[(13S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-yl]propanoate.
| Compound Name | methyl 3-[(13S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-yl]propanoate |
|---|---|
| PubChem CID | 90915606 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | methyl 3-[(13S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-yl]propanoate |
| SMILES | COC(=O)CCc1cc2c(cc1O)CCC1C2CC[C@]2(C)C(O)CCC12 |
| InChI | InChI=1S/C22H30O4/c1-22-10-9-15-16(18(22)6-7-20(22)24)5-3-13-12-19(23)14(11-17(13)15)4-8-21(25)26-2/h11-12,15-16,18,20,23-24H,3-10H2,1-2H3/t15?,16?,18?,20?,22-/m0/s1 |
| InChIKey | DOYPKTZMPBSZQX-WAZPUZNWSA-N |
| XLogP | 3.71 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |