C23H32O4 — CID 91587379
ethyl 3-[(13S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-yl]propanoate (PubChem CID 91587379) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is ethyl 3-[(13S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-yl]propanoate.
| Compound Name | ethyl 3-[(13S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-yl]propanoate |
|---|---|
| PubChem CID | 91587379 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | ethyl 3-[(13S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-yl]propanoate |
| SMILES | CCOC(=O)CCc1cc2c(cc1O)CCC1C2CC[C@]2(C)C(O)CCC12 |
| InChI | InChI=1S/C23H32O4/c1-3-27-22(26)9-5-15-12-18-14(13-20(15)24)4-6-17-16(18)10-11-23(2)19(17)7-8-21(23)25/h12-13,16-17,19,21,24-25H,3-11H2,1-2H3/t16?,17?,19?,21?,23-/m0/s1 |
| InChIKey | PIYRBIQSGRJYNP-WUARHYPRSA-N |
| XLogP | 4.10 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |