C20H27FO3 — CID 25023215
(13S,17S)-2-(2-fluoroethoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 25023215) has the molecular formula C20H27FO3 and a molecular weight of 334.43 g/mol. Its IUPAC name is (13S,17S)-2-(2-fluoroethoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (13S,17S)-2-(2-fluoroethoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 25023215 |
| Molecular Formula | C20H27FO3 |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | (13S,17S)-2-(2-fluoroethoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12CCC3c4cc(OCCF)c(O)cc4CCC3C1CC[C@@H]2O |
| InChI | InChI=1S/C20H27FO3/c1-20-7-6-13-14(16(20)4-5-19(20)23)3-2-12-10-17(22)18(11-15(12)13)24-9-8-21/h10-11,13-14,16,19,22-23H,2-9H2,1H3/t13?,14?,16?,19-,20-/m0/s1 |
| InChIKey | VGBOZKCPANULQX-BMSRGXOESA-N |
| XLogP | 3.96 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |