C20H25F3O3 — CID 54301289
(13S)-13-methyl-2-(2,2,2-trifluoroethoxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 54301289) has the molecular formula C20H25F3O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is (13S)-13-methyl-2-(2,2,2-trifluoroethoxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (13S)-13-methyl-2-(2,2,2-trifluoroethoxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 54301289 |
| Molecular Formula | C20H25F3O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | (13S)-13-methyl-2-(2,2,2-trifluoroethoxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12CCC3c4cc(OCC(F)(F)F)c(O)cc4CCC3C1CCC2O |
| InChI | InChI=1S/C20H25F3O3/c1-19-7-6-12-13(15(19)4-5-18(19)25)3-2-11-8-16(24)17(9-14(11)12)26-10-20(21,22)23/h8-9,12-13,15,18,24-25H,2-7,10H2,1H3/t12?,13?,15?,18?,19-/m0/s1 |
| InChIKey | SEJLRFOCUWYOPK-VKYAZVNUSA-N |
| XLogP | 4.55 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |