C30H42O2 — CID 11761880
(4R,7S,8S,11S,12R,20R,21S,24S,25S,28R)-7,25-dimethylheptacyclo[15.11.0.03,15.04,12.07,11.020,28.021,25]octacosa-1(17),2,15-triene-8,24-diol (PubChem CID 11761880) has the molecular formula C30H42O2 and a molecular weight of 434.66 g/mol. Its IUPAC name is (4R,7S,8S,11S,12R,20R,21S,24S,25S,28R)-7,25-dimethylheptacyclo[15.11.0.03,15.04,12.07,11.020,28.021,25]octacosa-1(17),2,15-triene-8,24-diol.
| Compound Name | (4R,7S,8S,11S,12R,20R,21S,24S,25S,28R)-7,25-dimethylheptacyclo[15.11.0.03,15.04,12.07,11.020,28.021,25]octacosa-1(17),2,15-triene-8,24-diol |
|---|---|
| PubChem CID | 11761880 |
| Molecular Formula | C30H42O2 |
| Molecular Weight | 434.66 g/mol |
| Exact Mass | 434.32 |
| IUPAC Name | (4R,7S,8S,11S,12R,20R,21S,24S,25S,28R)-7,25-dimethylheptacyclo[15.11.0.03,15.04,12.07,11.020,28.021,25]octacosa-1(17),2,15-triene-8,24-diol |
| SMILES | C[C@]12CC[C@H]3c4cc5c(cc4CC[C@H]3[C@@H]1CC[C@@H]2O)CC[C@@H]1[C@H]5CC[C@]2(C)[C@@H](O)CC[C@@H]12 |
| InChI | InChI=1S/C30H42O2/c1-29-13-11-19-21(25(29)7-9-27(29)31)5-3-17-15-18-4-6-22-20(24(18)16-23(17)19)12-14-30(2)26(22)8-10-28(30)32/h15-16,19-22,25-28,31-32H,3-14H2,1-2H3/t19-,20-,21-,22-,25+,26+,27+,28+,29+,30+/m1/s1 |
| InChIKey | JMFIIYQRWLBQIA-FQMVVPCESA-N |
| XLogP | 6.12 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.66 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |